C48H33N2O2Pt- — CID 170524476
2-methyl-6-[6-[3-[6-methyl-4-(6-phenyldibenzofuran-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 170524476) has the molecular formula C48H33N2O2Pt- and a molecular weight of 864.88 g/mol. Its IUPAC name is 2-methyl-6-[6-[3-[6-methyl-4-(6-phenyldibenzofuran-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-methyl-6-[6-[3-[6-methyl-4-(6-phenyldibenzofuran-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170524476 |
| Molecular Formula | C48H33N2O2Pt- |
| Molecular Weight | 864.88 g/mol |
| Exact Mass | 864.22 |
| IUPAC Name | 2-methyl-6-[6-[3-[6-methyl-4-(6-phenyldibenzofuran-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | Cc1cc(-c2cccc3c2oc2c(-c4ccccc4)cccc23)cc(-c2[c-]c(-c3cc(-c4ccccc4)cc(-c4cccc(C)c4O)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C48H33N2O2.Pt/c1-30-13-9-24-42(46(30)51)45-28-36(32-14-5-3-6-15-32)27-44(50-45)35-19-10-18-34(26-35)43-29-37(25-31(2)49-43)39-21-12-23-41-40-22-11-20-38(47(40)52-48(39)41)33-16-7-4-8-17-33;/h3-25,27-29,51H,1-2H3;/q-1; |
| InChIKey | COHJSYMYZMRPIG-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.88 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|