C53H33N2O3Pt- — CID 170524423
2-[6-[3-[4-(3-dibenzofuran-3-yl-2-benzofuran-1-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]naphthalen-1-ol;platinum (PubChem CID 170524423) has the molecular formula C53H33N2O3Pt- and a molecular weight of 940.94 g/mol. Its IUPAC name is 2-[6-[3-[4-(3-dibenzofuran-3-yl-2-benzofuran-1-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]naphthalen-1-ol;platinum.
| Compound Name | 2-[6-[3-[4-(3-dibenzofuran-3-yl-2-benzofuran-1-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]naphthalen-1-ol;platinum |
|---|---|
| PubChem CID | 170524423 |
| Molecular Formula | C53H33N2O3Pt- |
| Molecular Weight | 940.94 g/mol |
| Exact Mass | 940.21 |
| IUPAC Name | 2-[6-[3-[4-(3-dibenzofuran-3-yl-2-benzofuran-1-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]naphthalen-1-ol;platinum |
| SMILES | Cc1cc(-c2oc(-c3ccc4c(c3)oc3ccccc34)c3ccccc23)cc(-c2[c-]c(-c3cc(-c4ccccc4)cc(-c4ccc5ccccc5c4O)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C53H33N2O3.Pt/c1-32-26-39(53-44-20-8-7-19-43(44)52(58-53)37-23-24-42-41-18-9-10-21-49(41)57-50(42)31-37)30-46(54-32)35-15-11-16-36(27-35)47-28-38(33-12-3-2-4-13-33)29-48(55-47)45-25-22-34-14-5-6-17-40(34)51(45)56;/h2-26,28-31,56H,1H3;/q-1; |
| InChIKey | SKBDTBZNHGFJPM-UHFFFAOYSA-N |
| XLogP | 14.09 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.94 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|