C58H42N3OPt- — CID 170524307
2-[6-[3-[4-[3-(9,9-dimethylfluoren-2-yl)-1-phenylindol-2-yl]-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 170524307) has the molecular formula C58H42N3OPt- and a molecular weight of 992.07 g/mol. Its IUPAC name is 2-[6-[3-[4-[3-(9,9-dimethylfluoren-2-yl)-1-phenylindol-2-yl]-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[4-[3-(9,9-dimethylfluoren-2-yl)-1-phenylindol-2-yl]-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170524307 |
| Molecular Formula | C58H42N3OPt- |
| Molecular Weight | 992.07 g/mol |
| Exact Mass | 991.30 |
| IUPAC Name | 2-[6-[3-[4-[3-(9,9-dimethylfluoren-2-yl)-1-phenylindol-2-yl]-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | Cc1cc(-c2c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccccc3n2-c2ccccc2)cc(-c2[c-]c(-c3cc(-c4ccccc4)cc(-c4ccccc4O)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C58H42N3O.Pt/c1-37-31-43(36-51(59-37)39-19-16-20-40(32-39)52-34-42(38-17-6-4-7-18-38)35-53(60-52)47-24-12-15-28-55(47)62)57-56(48-25-11-14-27-54(48)61(57)44-21-8-5-9-22-44)41-29-30-46-45-23-10-13-26-49(45)58(2,3)50(46)33-41;/h4-31,33-36,62H,1-3H3;/q-1; |
| InChIKey | OUOKXEPVGULQDS-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.07 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|