C61H49F3N3OPt- — CID 170676719
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-[2-(trifluoromethyl)phenyl]phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 170676719) has the molecular formula C61H49F3N3OPt- and a molecular weight of 1092.15 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-[2-(trifluoromethyl)phenyl]phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-[2-(trifluoromethyl)phenyl]phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170676719 |
| Molecular Formula | C61H49F3N3OPt- |
| Molecular Weight | 1092.15 g/mol |
| Exact Mass | 1091.35 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-[2-(trifluoromethyl)phenyl]phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4cc(-c5cccc6c7ccccc7n(-c7ccc(-c8ccccc8C(F)(F)F)cc7)c56)ccn4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C61H49F3N3O.Pt/c1-59(2,3)44-32-42(33-45(37-44)60(4,5)6)43-35-54(66-55(36-43)51-19-9-12-24-57(51)68)41-16-13-15-40(31-41)53-34-39(29-30-65-53)48-20-14-21-50-49-18-8-11-23-56(49)67(58(48)50)46-27-25-38(26-28-46)47-17-7-10-22-52(47)61(62,63)64;/h7-30,32-37,68H,1-6H3;/q-1; |
| InChIKey | DAAZHUXKVTXETM-UHFFFAOYSA-N |
| XLogP | 16.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.15 |
| LogP ≤ 5 | 16.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|