C46H47N2OPt- — CID 162471850
2-[6-[3-[4-(4-tert-butylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum (PubChem CID 162471850) has the molecular formula C46H47N2OPt- and a molecular weight of 838.97 g/mol. Its IUPAC name is 2-[6-[3-[4-(4-tert-butylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[4-(4-tert-butylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 162471850 |
| Molecular Formula | C46H47N2OPt- |
| Molecular Weight | 838.97 g/mol |
| Exact Mass | 838.33 |
| IUPAC Name | 2-[6-[3-[4-(4-tert-butylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-c2ccnc(-c3[c-]c(-c4cc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc(-c5ccccc5O)n4)ccc3)c2)cc1.[Pt] |
| InChI | InChI=1S/C46H47N2O.Pt/c1-44(2,3)36-19-17-30(18-20-36)31-21-22-47-40(26-31)32-13-12-14-33(23-32)41-27-35(28-42(48-41)39-15-10-11-16-43(39)49)34-24-37(45(4,5)6)29-38(25-34)46(7,8)9;/h10-22,24-29,49H,1-9H3;/q-1; |
| InChIKey | RZGMNDYROYTFTI-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.97 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|