C44H39N2OPt- — CID 165162052
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(3-ethynylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 165162052) has the molecular formula C44H39N2OPt- and a molecular weight of 806.89 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(3-ethynylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(3-ethynylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 165162052 |
| Molecular Formula | C44H39N2OPt- |
| Molecular Weight | 806.89 g/mol |
| Exact Mass | 806.27 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(3-ethynylphenyl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | C#Cc1cccc(-c2ccnc(-c3[c-]c(-c4cc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc(-c5ccccc5O)n4)ccc3)c2)c1.[Pt] |
| InChI | InChI=1S/C44H39N2O.Pt/c1-8-29-13-11-14-30(21-29)31-19-20-45-39(25-31)32-15-12-16-33(22-32)40-26-35(27-41(46-40)38-17-9-10-18-42(38)47)34-23-36(43(2,3)4)28-37(24-34)44(5,6)7;/h1,9-21,23-28,47H,2-7H3;/q-1; |
| InChIKey | VRNVXWHOSFGLBA-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.89 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|