C44H40N2O — CID 165162060
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-ethynylphenyl)-2-pyridinyl]phenyl]-2-pyridinyl]phenol (PubChem CID 165162060) has the molecular formula C44H40N2O and a molecular weight of 612.82 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-ethynylphenyl)-2-pyridinyl]phenyl]-2-pyridinyl]phenol.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-ethynylphenyl)-2-pyridinyl]phenyl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 165162060 |
| Molecular Formula | C44H40N2O |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-ethynylphenyl)-2-pyridinyl]phenyl]-2-pyridinyl]phenol |
| SMILES | C#Cc1ccccc1-c1ccnc(-c2cccc(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4ccccc4O)n3)c2)c1 |
| InChI | InChI=1S/C44H40N2O/c1-8-29-14-9-10-17-37(29)30-20-21-45-39(25-30)31-15-13-16-32(22-31)40-26-34(27-41(46-40)38-18-11-12-19-42(38)47)33-23-35(43(2,3)4)28-36(24-33)44(5,6)7/h1,9-28,47H,2-7H3 |
| InChIKey | NBCZWUSSJUSMQJ-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|