C53H69N — CID 158776807
2,6-bis(3,5-ditert-butylphenyl)-4-[3-(3,5-ditert-butylphenyl)phenyl]pyridine (PubChem CID 158776807) has the molecular formula C53H69N and a molecular weight of 720.14 g/mol. Its IUPAC name is 2,6-bis(3,5-ditert-butylphenyl)-4-[3-(3,5-ditert-butylphenyl)phenyl]pyridine.
| Compound Name | 2,6-bis(3,5-ditert-butylphenyl)-4-[3-(3,5-ditert-butylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 158776807 |
| Molecular Formula | C53H69N |
| Molecular Weight | 720.14 g/mol |
| Exact Mass | 719.54 |
| IUPAC Name | 2,6-bis(3,5-ditert-butylphenyl)-4-[3-(3,5-ditert-butylphenyl)phenyl]pyridine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)nc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C53H69N/c1-48(2,3)40-23-36(24-41(31-40)49(4,5)6)34-20-19-21-35(22-34)37-29-46(38-25-42(50(7,8)9)32-43(26-38)51(10,11)12)54-47(30-37)39-27-44(52(13,14)15)33-45(28-39)53(16,17)18/h19-33H,1-18H3 |
| InChIKey | AUPRMQVAMMTQHJ-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.14 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |