C36H43N — CID 171730460
4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]-6-phenylaniline (PubChem CID 171730460) has the molecular formula C36H43N and a molecular weight of 489.75 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]-6-phenylaniline.
| Compound Name | 4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]-6-phenylaniline |
|---|---|
| PubChem CID | 171730460 |
| Molecular Formula | C36H43N |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | 4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]-6-phenylaniline |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(C(C)(C)C)cc(-c4ccccc4)c3N)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H43N/c1-34(2,3)28-19-27(20-29(21-28)35(4,5)6)25-16-13-17-26(18-25)32-23-30(36(7,8)9)22-31(33(32)37)24-14-11-10-12-15-24/h10-23H,37H2,1-9H3 |
| InChIKey | QQHSMRHRWSODCJ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|