About 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene
2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene (PubChem CID 140865935) has the molecular formula C40H34
and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene.
Molecular Properties
| Compound Name | 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene |
| PubChem CID | 140865935 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene |
| SMILES | CC(C)(C)c1cccc(-c2cccc(-c3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C40H34/c1-40(2,3)36-24-14-22-33(26-36)32-21-13-23-34(25-32)39-37(30-17-9-5-10-18-30)27-35(29-15-7-4-8-16-29)28-38(39)31-19-11-6-12-20-31/h4-28H,1-3H3 |
| InChIKey | HMARHZQIANRTBB-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene?
The IUPAC name of 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene (CID 140865935) is 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene.
What is the SMILES notation for 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene?
The canonical SMILES for 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene is CC(C)(C)c1cccc(-c2cccc(-c3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)c2)c1.
What is the InChIKey of 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene?
The InChIKey is HMARHZQIANRTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H34/c1-40(2,3)36-24-14-22-33(26-36)32-21-13-23-34(25-32)39-37(30-17-9-5-10-18-30)27-35(29-15-7-4-8-16-29)28-38(39)31-19-11-6-12-20-31/h4-28H,1-3H3.
What are the key properties of 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene?
2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene has a molecular weight of 514.71 g/mol, XLogP of 11.32, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-tert-butylphenyl)phenyl]-1,3,5-triphenylbenzene is sourced from PubChem (CID 140865935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).