C42H34S — CID 156553641
1-(4-tert-butyl-2,6-diphenylphenyl)-3-(3-phenylphenyl)-2-benzothiophene (PubChem CID 156553641) has the molecular formula C42H34S and a molecular weight of 570.80 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-diphenylphenyl)-3-(3-phenylphenyl)-2-benzothiophene.
| Compound Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-3-(3-phenylphenyl)-2-benzothiophene |
|---|---|
| PubChem CID | 156553641 |
| Molecular Formula | C42H34S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-3-(3-phenylphenyl)-2-benzothiophene |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(-c2sc(-c3cccc(-c4ccccc4)c3)c3ccccc23)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C42H34S/c1-42(2,3)34-27-37(30-18-9-5-10-19-30)39(38(28-34)31-20-11-6-12-21-31)41-36-25-14-13-24-35(36)40(43-41)33-23-15-22-32(26-33)29-16-7-4-8-17-29/h4-28H,1-3H3 |
| InChIKey | CGXRUKDRTQFXLP-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |