C68H56S — CID 139312523
2,8-ditert-butyl-4,6-bis[3-(3,5-diphenylphenyl)phenyl]dibenzothiophene (PubChem CID 139312523) has the molecular formula C68H56S and a molecular weight of 905.26 g/mol. Its IUPAC name is 2,8-ditert-butyl-4,6-bis[3-(3,5-diphenylphenyl)phenyl]dibenzothiophene.
| Compound Name | 2,8-ditert-butyl-4,6-bis[3-(3,5-diphenylphenyl)phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 139312523 |
| Molecular Formula | C68H56S |
| Molecular Weight | 905.26 g/mol |
| Exact Mass | 904.41 |
| IUPAC Name | 2,8-ditert-butyl-4,6-bis[3-(3,5-diphenylphenyl)phenyl]dibenzothiophene |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)c2sc3c(-c4cccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c4)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C68H56S/c1-67(2,3)59-41-61(51-31-19-29-49(33-51)57-37-53(45-21-11-7-12-22-45)35-54(38-57)46-23-13-8-14-24-46)65-63(43-59)64-44-60(68(4,5)6)42-62(66(64)69-65)52-32-20-30-50(34-52)58-39-55(47-25-15-9-16-26-47)36-56(40-58)48-27-17-10-18-28-48/h7-44H,1-6H3 |
| InChIKey | MVZXELUOEQVVCK-UHFFFAOYSA-N |
| XLogP | 19.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.26 |
| LogP ≤ 5 | 19.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |