C20H26 — CID 12682933
1-tert-butyl-3-(4-tert-butylphenyl)benzene (PubChem CID 12682933) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-tert-butylphenyl)benzene.
| Compound Name | 1-tert-butyl-3-(4-tert-butylphenyl)benzene |
|---|---|
| PubChem CID | 12682933 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-tert-butyl-3-(4-tert-butylphenyl)benzene |
| SMILES | CC(C)(C)c1ccc(-c2cccc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C20H26/c1-19(2,3)17-12-10-15(11-13-17)16-8-7-9-18(14-16)20(4,5)6/h7-14H,1-6H3 |
| InChIKey | WKWKEEGSNWMPMF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |