C23H21N — CID 165376163
3-[3-(4-tert-butylphenyl)phenyl]benzonitrile (PubChem CID 165376163) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[3-(4-tert-butylphenyl)phenyl]benzonitrile.
| Compound Name | 3-[3-(4-tert-butylphenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 165376163 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-[3-(4-tert-butylphenyl)phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3cccc(C#N)c3)c2)cc1 |
| InChI | InChI=1S/C23H21N/c1-23(2,3)22-12-10-18(11-13-22)20-8-5-9-21(15-20)19-7-4-6-17(14-19)16-24/h4-15H,1-3H3 |
| InChIKey | GVPYILCERSURBT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |