C20H20S — CID 174720161
2-[3-(4-tert-butylphenyl)phenyl]thiophene (PubChem CID 174720161) has the molecular formula C20H20S and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)phenyl]thiophene.
| Compound Name | 2-[3-(4-tert-butylphenyl)phenyl]thiophene |
|---|---|
| PubChem CID | 174720161 |
| Molecular Formula | C20H20S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)phenyl]thiophene |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3cccs3)c2)cc1 |
| InChI | InChI=1S/C20H20S/c1-20(2,3)18-11-9-15(10-12-18)16-6-4-7-17(14-16)19-8-5-13-21-19/h4-14H,1-3H3 |
| InChIKey | OIGBKFNEWLQBEA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |