C42H47N — CID 175535490
4-tert-butyl-N-[3-tert-butyl-5-(3-tert-butylphenyl)phenyl]-2,6-diphenylaniline (PubChem CID 175535490) has the molecular formula C42H47N and a molecular weight of 565.85 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-tert-butyl-5-(3-tert-butylphenyl)phenyl]-2,6-diphenylaniline.
| Compound Name | 4-tert-butyl-N-[3-tert-butyl-5-(3-tert-butylphenyl)phenyl]-2,6-diphenylaniline |
|---|---|
| PubChem CID | 175535490 |
| Molecular Formula | C42H47N |
| Molecular Weight | 565.85 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | 4-tert-butyl-N-[3-tert-butyl-5-(3-tert-butylphenyl)phenyl]-2,6-diphenylaniline |
| SMILES | CC(C)(C)c1cccc(-c2cc(Nc3c(-c4ccccc4)cc(C(C)(C)C)cc3-c3ccccc3)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C42H47N/c1-40(2,3)33-22-16-21-31(23-33)32-24-34(41(4,5)6)26-36(25-32)43-39-37(29-17-12-10-13-18-29)27-35(42(7,8)9)28-38(39)30-19-14-11-15-20-30/h10-28,43H,1-9H3 |
| InChIKey | XQKSVYYYXHEYAC-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.85 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |