C52H42N2 — CID 172518472
4-tert-butyl-N-[3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]-2,6-bis(3-phenylphenyl)aniline (PubChem CID 172518472) has the molecular formula C52H42N2 and a molecular weight of 702.97 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]-2,6-bis(3-phenylphenyl)aniline.
| Compound Name | 4-tert-butyl-N-[3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]-2,6-bis(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 172518472 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 702.97 g/mol |
| Exact Mass | 702.39 |
| IUPAC Name | 4-tert-butyl-N-[3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]-2,6-bis(3-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cccc(Nc2c(-c3cccc(-c4ccccc4)c3)cc(C(C)(C)C)cc2-c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C52H42N2/c1-52(2,3)42-33-47(40-23-14-21-38(31-40)36-17-6-4-7-18-36)51(48(34-42)41-24-15-22-39(32-41)37-19-8-5-9-20-37)53-43-25-16-26-44(35-43)54-49-29-12-10-27-45(49)46-28-11-13-30-50(46)54/h4-35,53H,1-3H3/i10D,11D,12D,13D,27D,28D,29D,30D |
| InChIKey | JXZQNIOJQBVAPL-FWUVANFJSA-N |
| XLogP | 14.49 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.97 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |