C56H66N2 — CID 169076670
4-tert-butyl-2,6-bis(4-tert-butylphenyl)-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline (PubChem CID 169076670) has the molecular formula C56H66N2 and a molecular weight of 767.16 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(4-tert-butylphenyl)-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline.
| Compound Name | 4-tert-butyl-2,6-bis(4-tert-butylphenyl)-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline |
|---|---|
| PubChem CID | 169076670 |
| Molecular Formula | C56H66N2 |
| Molecular Weight | 767.16 g/mol |
| Exact Mass | 766.52 |
| IUPAC Name | 4-tert-butyl-2,6-bis(4-tert-butylphenyl)-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(C)(C)C)cc(-c3ccc(C(C)(C)C)cc3)c2Nc2cccc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)c2)cc1 |
| InChI | InChI=1S/C56H66N2/c1-52(2,3)38-23-19-36(20-24-38)45-33-42(56(13,14)15)34-46(37-21-25-39(26-22-37)53(4,5)6)51(45)57-43-17-16-18-44(35-43)58-49-29-27-40(54(7,8)9)31-47(49)48-32-41(55(10,11)12)28-30-50(48)58/h16-35,57H,1-15H3 |
| InChIKey | ZDQQQCLNUSNFGP-UHFFFAOYSA-N |
| XLogP | 16.35 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.16 |
| LogP ≤ 5 | 16.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |