C64H62N2S — CID 67473630
3,6-ditert-butyl-9-[3-[8-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]dibenzothiophen-2-yl]phenyl]carbazole (PubChem CID 67473630) has the molecular formula C64H62N2S and a molecular weight of 891.28 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[3-[8-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]dibenzothiophen-2-yl]phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[3-[8-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]dibenzothiophen-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 67473630 |
| Molecular Formula | C64H62N2S |
| Molecular Weight | 891.28 g/mol |
| Exact Mass | 890.46 |
| IUPAC Name | 3,6-ditert-butyl-9-[3-[8-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]dibenzothiophen-2-yl]phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc(-c2ccc3sc4ccc(-c5cccc(-n6c7ccc(C(C)(C)C)cc7c7cc(C(C)(C)C)ccc76)c5)cc4c3c2)c1 |
| InChI | InChI=1S/C64H62N2S/c1-61(2,3)43-21-25-55-49(35-43)50-36-44(62(4,5)6)22-26-56(50)65(55)47-17-13-15-39(31-47)41-19-29-59-53(33-41)54-34-42(20-30-60(54)67-59)40-16-14-18-48(32-40)66-57-27-23-45(63(7,8)9)37-51(57)52-38-46(64(10,11)12)24-28-58(52)66/h13-38H,1-12H3 |
| InChIKey | XMBXDUKDLSHGNY-UHFFFAOYSA-N |
| XLogP | 18.77 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.28 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |