C40H32N2 — CID 59399854
3-tert-butyl-6-deuterio-9-[3-[3-(3,6-dideuteriocarbazol-9-yl)phenyl]phenyl]carbazole (PubChem CID 59399854) has the molecular formula C40H32N2 and a molecular weight of 543.73 g/mol. Its IUPAC name is 3-tert-butyl-6-deuterio-9-[3-[3-(3,6-dideuteriocarbazol-9-yl)phenyl]phenyl]carbazole.
| Compound Name | 3-tert-butyl-6-deuterio-9-[3-[3-(3,6-dideuteriocarbazol-9-yl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 59399854 |
| Molecular Formula | C40H32N2 |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 3-tert-butyl-6-deuterio-9-[3-[3-(3,6-dideuteriocarbazol-9-yl)phenyl]phenyl]carbazole |
| SMILES | [2H]c1ccc2c(c1)c1cc([2H])ccc1n2-c1cccc(-c2cccc(-n3c4ccc([2H])cc4c4cc(C(C)(C)C)ccc43)c2)c1 |
| InChI | InChI=1S/C40H32N2/c1-40(2,3)29-22-23-39-35(26-29)34-18-6-9-21-38(34)42(39)31-15-11-13-28(25-31)27-12-10-14-30(24-27)41-36-19-7-4-16-32(36)33-17-5-8-20-37(33)41/h4-26H,1-3H3/i4D,5D,6D |
| InChIKey | JJVWXVBGZADIJA-WVALGTIDSA-N |
| XLogP | 10.85 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |