C42H46N2 — CID 175408177
3,6-ditert-butyl-N-(4-tert-butyl-2,6-diphenylphenyl)carbazol-9-amine (PubChem CID 175408177) has the molecular formula C42H46N2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 3,6-ditert-butyl-N-(4-tert-butyl-2,6-diphenylphenyl)carbazol-9-amine.
| Compound Name | 3,6-ditert-butyl-N-(4-tert-butyl-2,6-diphenylphenyl)carbazol-9-amine |
|---|---|
| PubChem CID | 175408177 |
| Molecular Formula | C42H46N2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 3,6-ditert-butyl-N-(4-tert-butyl-2,6-diphenylphenyl)carbazol-9-amine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(Nn2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C42H46N2/c1-40(2,3)30-20-22-37-35(24-30)36-25-31(41(4,5)6)21-23-38(36)44(37)43-39-33(28-16-12-10-13-17-28)26-32(42(7,8)9)27-34(39)29-18-14-11-15-19-29/h10-27,43H,1-9H3 |
| InChIKey | GSKDTSGUEMVWSW-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |