C29H30N2 — CID 171416103
2-N-[2-(3-tert-butylphenyl)-6-phenyl-4-(trideuteriomethyl)phenyl]benzene-1,2-diamine (PubChem CID 171416103) has the molecular formula C29H30N2 and a molecular weight of 409.59 g/mol. Its IUPAC name is 2-N-[2-(3-tert-butylphenyl)-6-phenyl-4-(trideuteriomethyl)phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-(3-tert-butylphenyl)-6-phenyl-4-(trideuteriomethyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 171416103 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 2-N-[2-(3-tert-butylphenyl)-6-phenyl-4-(trideuteriomethyl)phenyl]benzene-1,2-diamine |
| SMILES | [2H]C([2H])([2H])c1cc(-c2ccccc2)c(Nc2ccccc2N)c(-c2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C29H30N2/c1-20-17-24(21-11-6-5-7-12-21)28(31-27-16-9-8-15-26(27)30)25(18-20)22-13-10-14-23(19-22)29(2,3)4/h5-19,31H,30H2,1-4H3/i1D3 |
| InChIKey | DFNSTROMBMCABR-FIBGUPNXSA-N |
| XLogP | 7.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|