C38H40N2 — CID 177082894
2-N-[2-(2-tert-butylphenyl)-4-(1,3-dideuterio-2-methylpropan-2-yl)-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]benzene-1,2-diamine (PubChem CID 177082894) has the molecular formula C38H40N2 and a molecular weight of 531.79 g/mol. Its IUPAC name is 2-N-[2-(2-tert-butylphenyl)-4-(1,3-dideuterio-2-methylpropan-2-yl)-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-(2-tert-butylphenyl)-4-(1,3-dideuterio-2-methylpropan-2-yl)-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 177082894 |
| Molecular Formula | C38H40N2 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | 2-N-[2-(2-tert-butylphenyl)-4-(1,3-dideuterio-2-methylpropan-2-yl)-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]benzene-1,2-diamine |
| SMILES | [2H]CC(C)(C[2H])c1cc(-c2ccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc2)c(Nc2ccccc2N)c(-c2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C38H40N2/c1-37(2,3)29-24-31(28-22-20-27(21-23-28)26-14-8-7-9-15-26)36(40-35-19-13-12-18-34(35)39)32(25-29)30-16-10-11-17-33(30)38(4,5)6/h7-25,40H,39H2,1-6H3/i1D,2D,7D,8D,9D,14D,15D |
| InChIKey | LFQGXYQWKARQFY-ONKCLHRUSA-N |
| XLogP | 10.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|