C22H23N — CID 169001736
4-tert-butyl-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)aniline (PubChem CID 169001736) has the molecular formula C22H23N and a molecular weight of 311.49 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)aniline.
| Compound Name | 4-tert-butyl-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
|---|---|
| PubChem CID | 169001736 |
| Molecular Formula | C22H23N |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 4-tert-butyl-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C(C)(C)C)cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2N)c([2H])c1[2H] |
| InChI | InChI=1S/C22H23N/c1-22(2,3)18-14-19(16-10-6-4-7-11-16)21(23)20(15-18)17-12-8-5-9-13-17/h4-15H,23H2,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D,13D |
| InChIKey | QDADOVYTWGTHOZ-MIPJZDBJSA-N |
| XLogP | 5.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|