C24H21N — CID 88961806
1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)benzene;2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline (PubChem CID 88961806) has the molecular formula C24H21N and a molecular weight of 342.55 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)benzene;2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)benzene;2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline |
|---|---|
| PubChem CID | 88961806 |
| Molecular Formula | C24H21N |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)benzene;2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N)c([2H])c2[2H])c([2H])c1[2H].[2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C12H11N.C12H10/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-9H,13H2;1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D;1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | QKRKFLQMKFSUMG-CXYYXPRTSA-N |
| XLogP | 6.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|