C18H15N — CID 171402884
3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline (PubChem CID 171402884) has the molecular formula C18H15N and a molecular weight of 255.39 g/mol. Its IUPAC name is 3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline.
| Compound Name | 3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
|---|---|
| PubChem CID | 171402884 |
| Molecular Formula | C18H15N |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(N)cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C18H15N/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H,19H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | PWRKEYBSOWAIMY-LHNTUAQVSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|