C12H8BrCl — CID 169297845
1-(3-bromo-5-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 169297845) has the molecular formula C12H8BrCl and a molecular weight of 272.58 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 169297845 |
| Molecular Formula | C12H8BrCl |
| Molecular Weight | 272.58 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(Cl)cc(Br)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C12H8BrCl/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-8H/i1D,2D,3D,4D,5D |
| InChIKey | SJLJTKRBBCLGPR-RALIUCGRSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |