C12H9Br — CID 88865397
1-(3-bromophenyl)-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 88865397) has the molecular formula C12H9Br and a molecular weight of 238.14 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-(3-bromophenyl)-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 88865397 |
| Molecular Formula | C12H9Br |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1-(3-bromophenyl)-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(Br)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C12H9Br/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H/i1D,2D,3D,5D,6D |
| InChIKey | USYQKCQEVBFJRP-XFEWCBMOSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |