About 1-bromo-3-phenylbenzene;ethane
1-bromo-3-phenylbenzene;ethane (PubChem CID 163977967) has the molecular formula C14H15Br
and a molecular weight of 263.18 g/mol. Its IUPAC name is 1-bromo-3-phenylbenzene;ethane.
Molecular Properties
| Compound Name | 1-bromo-3-phenylbenzene;ethane |
| PubChem CID | 163977967 |
| Molecular Formula | C14H15Br |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-bromo-3-phenylbenzene;ethane |
| SMILES | Brc1cccc(-c2ccccc2)c1.CC |
| InChI | InChI=1S/C12H9Br.C2H6/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-2/h1-9H;1-2H3 |
| InChIKey | SVVIRXXZODNECH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-phenylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-phenylbenzene;ethane?
The IUPAC name of 1-bromo-3-phenylbenzene;ethane (CID 163977967) is 1-bromo-3-phenylbenzene;ethane.
What is the SMILES notation for 1-bromo-3-phenylbenzene;ethane?
The canonical SMILES for 1-bromo-3-phenylbenzene;ethane is Brc1cccc(-c2ccccc2)c1.CC.
What is the InChIKey of 1-bromo-3-phenylbenzene;ethane?
The InChIKey is SVVIRXXZODNECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br.C2H6/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-2/h1-9H;1-2H3.
What are the key properties of 1-bromo-3-phenylbenzene;ethane?
1-bromo-3-phenylbenzene;ethane has a molecular weight of 263.18 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-phenylbenzene;ethane is sourced from PubChem (CID 163977967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).