C26H16Br2 — CID 142699048
2,6-dibromo-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracene (PubChem CID 142699048) has the molecular formula C26H16Br2 and a molecular weight of 498.28 g/mol. Its IUPAC name is 2,6-dibromo-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracene.
| Compound Name | 2,6-dibromo-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracene |
|---|---|
| PubChem CID | 142699048 |
| Molecular Formula | C26H16Br2 |
| Molecular Weight | 498.28 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 2,6-dibromo-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccc(Br)cc3c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccc(Br)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C26H16Br2/c27-19-12-14-22-23(15-19)25(17-7-3-1-4-8-17)21-13-11-20(28)16-24(21)26(22)18-9-5-2-6-10-18/h1-16H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | VPRYGSKSLDELAY-LHNTUAQVSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.28 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|