C38H26 — CID 140747032
9,10-bis(2,3,4,5,6-pentadeuteriophenyl)-2,6-diphenylanthracene (PubChem CID 140747032) has the molecular formula C38H26 and a molecular weight of 492.69 g/mol. Its IUPAC name is 9,10-bis(2,3,4,5,6-pentadeuteriophenyl)-2,6-diphenylanthracene.
| Compound Name | 9,10-bis(2,3,4,5,6-pentadeuteriophenyl)-2,6-diphenylanthracene |
|---|---|
| PubChem CID | 140747032 |
| Molecular Formula | C38H26 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 9,10-bis(2,3,4,5,6-pentadeuteriophenyl)-2,6-diphenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccc(-c4ccccc4)cc3c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccc(-c4ccccc4)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C38H26/c1-5-13-27(14-6-1)31-21-23-33-35(25-31)37(29-17-9-3-10-18-29)34-24-22-32(28-15-7-2-8-16-28)26-36(34)38(33)30-19-11-4-12-20-30/h1-26H/i3D,4D,9D,10D,11D,12D,17D,18D,19D,20D |
| InChIKey | UXFIZVVATAZJIV-YBGSPRLPSA-N |
| XLogP | 10.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|