C54H34 — CID 140593106
4-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)-3-phenylanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene (PubChem CID 140593106) has the molecular formula C54H34 and a molecular weight of 687.90 g/mol. Its IUPAC name is 4-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)-3-phenylanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene.
| Compound Name | 4-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)-3-phenylanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene |
|---|---|
| PubChem CID | 140593106 |
| Molecular Formula | C54H34 |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 687.30 |
| IUPAC Name | 4-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)-3-phenylanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc4c(-c5cccc6c5ccc5cc7ccccc7cc56)cccc34)c3ccc(-c4ccccc4)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C54H34/c1-3-14-35(15-4-1)39-28-31-50-52(34-39)53(36-16-5-2-6-17-36)48-20-9-10-21-49(48)54(50)47-27-13-24-42-41(22-11-25-44(42)47)43-23-12-26-45-46(43)30-29-40-32-37-18-7-8-19-38(37)33-51(40)45/h1-34H/i2D,5D,6D,16D,17D |
| InChIKey | DZPHEPKNFITDIJ-KZKSKIOJSA-N |
| XLogP | 15.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|