C50H32 — CID 140593081
4-[4-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]phenyl]benzo[a]anthracene (PubChem CID 140593081) has the molecular formula C50H32 and a molecular weight of 637.84 g/mol. Its IUPAC name is 4-[4-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]phenyl]benzo[a]anthracene.
| Compound Name | 4-[4-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]phenyl]benzo[a]anthracene |
|---|---|
| PubChem CID | 140593081 |
| Molecular Formula | C50H32 |
| Molecular Weight | 637.84 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | 4-[4-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]phenyl]benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3ccc(-c4ccc(-c5cccc6c5ccc5cc7ccccc7cc56)cc4)cc3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C50H32/c1-2-11-36(12-3-1)49-44-15-6-8-17-46(44)50(47-18-9-7-16-45(47)49)37-27-23-34(24-28-37)33-21-25-35(26-22-33)41-19-10-20-42-43(41)30-29-40-31-38-13-4-5-14-39(38)32-48(40)42/h1-32H/i1D,2D,3D,11D,12D |
| InChIKey | KMTRWGBLWMOFBO-QJJXXHCMSA-N |
| XLogP | 14.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.84 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|