C38H24S — CID 162423877
2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-7-phenyldibenzothiophene (PubChem CID 162423877) has the molecular formula C38H24S and a molecular weight of 517.71 g/mol. Its IUPAC name is 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-7-phenyldibenzothiophene.
| Compound Name | 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-7-phenyldibenzothiophene |
|---|---|
| PubChem CID | 162423877 |
| Molecular Formula | C38H24S |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-7-phenyldibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3ccc4sc5cc(-c6ccccc6)ccc5c4c3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C38H24S/c1-3-11-25(12-4-1)27-19-21-29-34-23-28(20-22-35(34)39-36(29)24-27)38-32-17-9-7-15-30(32)37(26-13-5-2-6-14-26)31-16-8-10-18-33(31)38/h1-24H/i2D,5D,6D,13D,14D |
| InChIKey | SLUQIRFNZRRPBR-LTTLSEBRSA-N |
| XLogP | 11.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|