C45H28N2S — CID 169071618
1-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169071618) has the molecular formula C45H28N2S and a molecular weight of 633.83 g/mol. Its IUPAC name is 1-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 1-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169071618 |
| Molecular Formula | C45H28N2S |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 1-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2c3ccccc3c(-c3ccc4sc5ccccc5c4c3)c3cc(-c4ccccc4)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H28N2S/c1-3-13-29(14-4-1)31-23-25-36-38(27-31)43(32-24-26-42-37(28-32)33-17-9-12-22-41(33)48-42)34-18-7-8-19-35(34)44(36)47-40-21-11-10-20-39(40)46-45(47)30-15-5-2-6-16-30/h1-28H/i2D,5D,6D,15D,16D |
| InChIKey | TULBZSOFULUGNT-KLZHWEBPSA-N |
| XLogP | 12.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|