C19H17Cl — CID 100958495
4-chloro-2,3,6-trimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene (PubChem CID 100958495) has the molecular formula C19H17Cl and a molecular weight of 285.83 g/mol. Its IUPAC name is 4-chloro-2,3,6-trimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene.
| Compound Name | 4-chloro-2,3,6-trimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
|---|---|
| PubChem CID | 100958495 |
| Molecular Formula | C19H17Cl |
| Molecular Weight | 285.83 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-chloro-2,3,6-trimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C)c(C)c(Cl)c3cc(C)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C19H17Cl/c1-12-9-10-16-17(11-12)19(20)14(3)13(2)18(16)15-7-5-4-6-8-15/h4-11H,1-3H3/i4D,5D,6D,7D,8D |
| InChIKey | AYDIJBJBNRZTGM-UPKDRLQUSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.83 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |