C15H12N2 — CID 101223785
2,3,6-trimethylnaphthalene-1,4-dicarbonitrile (PubChem CID 101223785) has the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2,3,6-trimethylnaphthalene-1,4-dicarbonitrile.
| Compound Name | 2,3,6-trimethylnaphthalene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 101223785 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2,3,6-trimethylnaphthalene-1,4-dicarbonitrile |
| SMILES | Cc1ccc2c(C#N)c(C)c(C)c(C#N)c2c1 |
| InChI | InChI=1S/C15H12N2/c1-9-4-5-12-13(6-9)15(8-17)11(3)10(2)14(12)7-16/h4-6H,1-3H3 |
| InChIKey | WTDXOVSLVBBKCC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |