C11H9ClN2 — CID 82269620
2-chloro-1,6-dimethylindole-3-carbonitrile (PubChem CID 82269620) has the molecular formula C11H9ClN2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 2-chloro-1,6-dimethylindole-3-carbonitrile.
| Compound Name | 2-chloro-1,6-dimethylindole-3-carbonitrile |
|---|---|
| PubChem CID | 82269620 |
| Molecular Formula | C11H9ClN2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-chloro-1,6-dimethylindole-3-carbonitrile |
| SMILES | Cc1ccc2c(C#N)c(Cl)n(C)c2c1 |
| InChI | InChI=1S/C11H9ClN2/c1-7-3-4-8-9(6-13)11(12)14(2)10(8)5-7/h3-5H,1-2H3 |
| InChIKey | CNORVCNQMUZORU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |