C12H8ClF3N2 — CID 59426450
2-chloro-1-ethyl-6-(trifluoromethyl)indole-3-carbonitrile (PubChem CID 59426450) has the molecular formula C12H8ClF3N2 and a molecular weight of 272.66 g/mol. Its IUPAC name is 2-chloro-1-ethyl-6-(trifluoromethyl)indole-3-carbonitrile.
| Compound Name | 2-chloro-1-ethyl-6-(trifluoromethyl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 59426450 |
| Molecular Formula | C12H8ClF3N2 |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-chloro-1-ethyl-6-(trifluoromethyl)indole-3-carbonitrile |
| SMILES | CCn1c(Cl)c(C#N)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H8ClF3N2/c1-2-18-10-5-7(12(14,15)16)3-4-8(10)9(6-17)11(18)13/h3-5H,2H2,1H3 |
| InChIKey | VPYOHRWZMPPYRF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |