C14H8F6N2 — CID 139575648
2,7-bis(trifluoromethyl)carbazol-9-amine (PubChem CID 139575648) has the molecular formula C14H8F6N2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 2,7-bis(trifluoromethyl)carbazol-9-amine.
| Compound Name | 2,7-bis(trifluoromethyl)carbazol-9-amine |
|---|---|
| PubChem CID | 139575648 |
| Molecular Formula | C14H8F6N2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2,7-bis(trifluoromethyl)carbazol-9-amine |
| SMILES | Nn1c2cc(C(F)(F)F)ccc2c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H8F6N2/c15-13(16,17)7-1-3-9-10-4-2-8(14(18,19)20)6-12(10)22(21)11(9)5-7/h1-6H,21H2 |
| InChIKey | ALFCLVOMYSAVKS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |