C17H15F6N — CID 142508322
ethane;9-methyl-2,7-bis(trifluoromethyl)carbazole (PubChem CID 142508322) has the molecular formula C17H15F6N and a molecular weight of 347.30 g/mol. Its IUPAC name is ethane;9-methyl-2,7-bis(trifluoromethyl)carbazole.
| Compound Name | ethane;9-methyl-2,7-bis(trifluoromethyl)carbazole |
|---|---|
| PubChem CID | 142508322 |
| Molecular Formula | C17H15F6N |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethane;9-methyl-2,7-bis(trifluoromethyl)carbazole |
| SMILES | CC.Cn1c2cc(C(F)(F)F)ccc2c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C15H9F6N.C2H6/c1-22-12-6-8(14(16,17)18)2-4-10(12)11-5-3-9(7-13(11)22)15(19,20)21;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | FWLSTMKWZLNRKR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |