C12H7F6NO — CID 175473195
2,2-difluoro-2-[1-methyl-6-(trifluoromethyl)indol-3-yl]acetyl fluoride (PubChem CID 175473195) has the molecular formula C12H7F6NO and a molecular weight of 295.18 g/mol. Its IUPAC name is 2,2-difluoro-2-[1-methyl-6-(trifluoromethyl)indol-3-yl]acetyl fluoride.
| Compound Name | 2,2-difluoro-2-[1-methyl-6-(trifluoromethyl)indol-3-yl]acetyl fluoride |
|---|---|
| PubChem CID | 175473195 |
| Molecular Formula | C12H7F6NO |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2,2-difluoro-2-[1-methyl-6-(trifluoromethyl)indol-3-yl]acetyl fluoride |
| SMILES | Cn1cc(C(F)(F)C(=O)F)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H7F6NO/c1-19-5-8(11(14,15)10(13)20)7-3-2-6(4-9(7)19)12(16,17)18/h2-5H,1H3 |
| InChIKey | CARMWZORJOTJFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|