C11H10BrF2N — CID 84713699
6-bromo-3-(1,1-difluoroethyl)-1-methylindole (PubChem CID 84713699) has the molecular formula C11H10BrF2N and a molecular weight of 274.11 g/mol. Its IUPAC name is 6-bromo-3-(1,1-difluoroethyl)-1-methylindole.
| Compound Name | 6-bromo-3-(1,1-difluoroethyl)-1-methylindole |
|---|---|
| PubChem CID | 84713699 |
| Molecular Formula | C11H10BrF2N |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 6-bromo-3-(1,1-difluoroethyl)-1-methylindole |
| SMILES | Cn1cc(C(C)(F)F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C11H10BrF2N/c1-11(13,14)9-6-15(2)10-5-7(12)3-4-8(9)10/h3-6H,1-2H3 |
| InChIKey | HTYVEQZIYLEJEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |