C10H7BrF2O — CID 84710327
5-bromo-3-(1,1-difluoroethyl)-1-benzofuran (PubChem CID 84710327) has the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-bromo-3-(1,1-difluoroethyl)-1-benzofuran.
| Compound Name | 5-bromo-3-(1,1-difluoroethyl)-1-benzofuran |
|---|---|
| PubChem CID | 84710327 |
| Molecular Formula | C10H7BrF2O |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 5-bromo-3-(1,1-difluoroethyl)-1-benzofuran |
| SMILES | CC(F)(F)c1coc2ccc(Br)cc12 |
| InChI | InChI=1S/C10H7BrF2O/c1-10(12,13)8-5-14-9-3-2-6(11)4-7(8)9/h2-5H,1H3 |
| InChIKey | WZEWRMZHMKDERP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |