C9H7F3N4O — CID 59320586
3,4-diamino-6-(trifluoromethyl)quinazolin-2-one (PubChem CID 59320586) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 3,4-diamino-6-(trifluoromethyl)quinazolin-2-one.
| Compound Name | 3,4-diamino-6-(trifluoromethyl)quinazolin-2-one |
|---|---|
| PubChem CID | 59320586 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3,4-diamino-6-(trifluoromethyl)quinazolin-2-one |
| SMILES | Nc1c2cc(C(F)(F)F)ccc2nc(=O)n1N |
| InChI | InChI=1S/C9H7F3N4O/c10-9(11,12)4-1-2-6-5(3-4)7(13)16(14)8(17)15-6/h1-3H,13-14H2 |
| InChIKey | AEAOVWOITNSTLN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |