C13H10F6N4O4 — CID 123983137
3,4-diamino-6-methylquinazolin-2-one;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 123983137) has the molecular formula C13H10F6N4O4 and a molecular weight of 400.24 g/mol. Its IUPAC name is 3,4-diamino-6-methylquinazolin-2-one;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 3,4-diamino-6-methylquinazolin-2-one;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 123983137 |
| Molecular Formula | C13H10F6N4O4 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3,4-diamino-6-methylquinazolin-2-one;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc2nc(=O)n(N)c(N)c2c1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10N4O.C4F6O3/c1-5-2-3-7-6(4-5)8(10)13(11)9(14)12-7;5-3(6,7)1(11)13-2(12)4(8,9)10/h2-4H,10-11H2,1H3; |
| InChIKey | OBZNWZVFSGBBBQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|