C12H17N3O — CID 155705578
2-amino-3,6-dimethylquinazolin-4-one;ethane (PubChem CID 155705578) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-amino-3,6-dimethylquinazolin-4-one;ethane.
| Compound Name | 2-amino-3,6-dimethylquinazolin-4-one;ethane |
|---|---|
| PubChem CID | 155705578 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-amino-3,6-dimethylquinazolin-4-one;ethane |
| SMILES | CC.Cc1ccc2nc(N)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C10H11N3O.C2H6/c1-6-3-4-8-7(5-6)9(14)13(2)10(11)12-8;1-2/h3-5H,1-2H3,(H2,11,12);1-2H3 |
| InChIKey | FMWIVBZBYYUUOL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |