C13H7F3N2O — CID 132503374
2-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one (PubChem CID 132503374) has the molecular formula C13H7F3N2O and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 2-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 132503374 |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2cc(C(F)(F)F)ccc2nc2ccccn12 |
| InChI | InChI=1S/C13H7F3N2O/c14-13(15,16)8-4-5-10-9(7-8)12(19)18-6-2-1-3-11(18)17-10/h1-7H |
| InChIKey | YMBPLABHQXBURB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|