C16H11F3N4O2 — CID 135514246
3-[(E)-hydroxyiminomethyl]-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 135514246) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 3-[(E)-hydroxyiminomethyl]-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(E)-hydroxyiminomethyl]-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135514246 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-[(E)-hydroxyiminomethyl]-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(/C=N/O)c(Nc2cccc(C(F)(F)F)c2)nc2ccccn12 |
| InChI | InChI=1S/C16H11F3N4O2/c17-16(18,19)10-4-3-5-11(8-10)21-14-12(9-20-25)15(24)23-7-2-1-6-13(23)22-14/h1-9,21,25H/b20-9+ |
| InChIKey | PXHCHSKJIPCGRT-AWQFTUOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|