C26H22F3N5O5 — CID 135717436
3,4,5-trimethoxy-N-[(E)-[4-oxo-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-3-yl]methylideneamino]benzamide (PubChem CID 135717436) has the molecular formula C26H22F3N5O5 and a molecular weight of 541.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(E)-[4-oxo-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-3-yl]methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(E)-[4-oxo-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135717436 |
| Molecular Formula | C26H22F3N5O5 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(E)-[4-oxo-2-[3-(trifluoromethyl)anilino]pyrido[1,2-a]pyrimidin-3-yl]methylideneamino]benzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2c(Nc3cccc(C(F)(F)F)c3)nc3ccccn3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H22F3N5O5/c1-37-19-11-15(12-20(38-2)22(19)39-3)24(35)33-30-14-18-23(32-21-9-4-5-10-34(21)25(18)36)31-17-8-6-7-16(13-17)26(27,28)29/h4-14,31H,1-3H3,(H,33,35)/b30-14+ |
| InChIKey | VVSCGJYQNNLYJQ-AMVVHIIESA-N |
| XLogP | 4.25 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|